C16H20N4O2 — CID 120606012
2-[(1-ethyl-2-oxo-3-pyridinyl)methyl]-1-(3-methoxyphenyl)guanidine (PubChem CID 120606012) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[(1-ethyl-2-oxo-3-pyridinyl)methyl]-1-(3-methoxyphenyl)guanidine.
| Compound Name | 2-[(1-ethyl-2-oxo-3-pyridinyl)methyl]-1-(3-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 120606012 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[(1-ethyl-2-oxo-3-pyridinyl)methyl]-1-(3-methoxyphenyl)guanidine |
| SMILES | CCn1cccc(C/N=C(\N)Nc2cccc(OC)c2)c1=O |
| InChI | InChI=1S/C16H20N4O2/c1-3-20-9-5-6-12(15(20)21)11-18-16(17)19-13-7-4-8-14(10-13)22-2/h4-10H,3,11H2,1-2H3,(H3,17,18,19) |
| InChIKey | SGIKSEFKNOZFDZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|