C19H35N3O5 — CID 120606871
2-[[4-(3-ethyl-2-morpholin-4-ylpentanoyl)morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 120606871) has the molecular formula C19H35N3O5 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[[4-(3-ethyl-2-morpholin-4-ylpentanoyl)morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-(3-ethyl-2-morpholin-4-ylpentanoyl)morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 120606871 |
| Molecular Formula | C19H35N3O5 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 2-[[4-(3-ethyl-2-morpholin-4-ylpentanoyl)morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CCC(CC)C(C(=O)N1CCOC(CN(C)CC(=O)O)C1)N1CCOCC1 |
| InChI | InChI=1S/C19H35N3O5/c1-4-15(5-2)18(21-6-9-26-10-7-21)19(25)22-8-11-27-16(13-22)12-20(3)14-17(23)24/h15-16,18H,4-14H2,1-3H3,(H,23,24) |
| InChIKey | UIFQKHZNAAMVTH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |