C17H26N2O4S — CID 120607450
methyl 3-[[1-(aminomethyl)-2-methylcyclohexyl]sulfamoyl]-2-methylbenzoate (PubChem CID 120607450) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is methyl 3-[[1-(aminomethyl)-2-methylcyclohexyl]sulfamoyl]-2-methylbenzoate.
| Compound Name | methyl 3-[[1-(aminomethyl)-2-methylcyclohexyl]sulfamoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 120607450 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | methyl 3-[[1-(aminomethyl)-2-methylcyclohexyl]sulfamoyl]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)NC2(CN)CCCCC2C)c1C |
| InChI | InChI=1S/C17H26N2O4S/c1-12-7-4-5-10-17(12,11-18)19-24(21,22)15-9-6-8-14(13(15)2)16(20)23-3/h6,8-9,12,19H,4-5,7,10-11,18H2,1-3H3 |
| InChIKey | OBPDFDHEPCEEGY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |