C15H23ClN2O3S — CID 120608067
3-(2-aminophenyl)-N-(1,1-dioxothiolan-3-yl)-N-ethylpropanamide;hydrochloride (PubChem CID 120608067) has the molecular formula C15H23ClN2O3S and a molecular weight of 346.88 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-(1,1-dioxothiolan-3-yl)-N-ethylpropanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-(1,1-dioxothiolan-3-yl)-N-ethylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120608067 |
| Molecular Formula | C15H23ClN2O3S |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 3-(2-aminophenyl)-N-(1,1-dioxothiolan-3-yl)-N-ethylpropanamide;hydrochloride |
| SMILES | CCN(C(=O)CCc1ccccc1N)C1CCS(=O)(=O)C1.Cl |
| InChI | InChI=1S/C15H22N2O3S.ClH/c1-2-17(13-9-10-21(19,20)11-13)15(18)8-7-12-5-3-4-6-14(12)16;/h3-6,13H,2,7-11,16H2,1H3;1H |
| InChIKey | IIHDSEKMVIHUOQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|