C18H24N2O3S — CID 8890878
N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-4-(1H-indol-3-yl)butanamide (PubChem CID 8890878) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-4-(1H-indol-3-yl)butanamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 8890878 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-4-(1H-indol-3-yl)butanamide |
| SMILES | CCN(C(=O)CCCc1c[nH]c2ccccc12)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H24N2O3S/c1-2-20(15-10-11-24(22,23)13-15)18(21)9-5-6-14-12-19-17-8-4-3-7-16(14)17/h3-4,7-8,12,15,19H,2,5-6,9-11,13H2,1H3/t15-/m1/s1 |
| InChIKey | ZTSGPCBSUODQHW-OAHLLOKOSA-N |
| XLogP | 2.53 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |