C14H21ClN2O3 — CID 120609255
methyl 2-[3-(2-aminophenyl)propanoylamino]-2-methylpropanoate;hydrochloride (PubChem CID 120609255) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is methyl 2-[3-(2-aminophenyl)propanoylamino]-2-methylpropanoate;hydrochloride.
| Compound Name | methyl 2-[3-(2-aminophenyl)propanoylamino]-2-methylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 120609255 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | methyl 2-[3-(2-aminophenyl)propanoylamino]-2-methylpropanoate;hydrochloride |
| SMILES | COC(=O)C(C)(C)NC(=O)CCc1ccccc1N.Cl |
| InChI | InChI=1S/C14H20N2O3.ClH/c1-14(2,13(18)19-3)16-12(17)9-8-10-6-4-5-7-11(10)15;/h4-7H,8-9,15H2,1-3H3,(H,16,17);1H |
| InChIKey | RGKDYMPPEBOOJD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|