C17H29ClN2O — CID 120611896
3-(2-aminophenyl)-N-(2,2-diethylbutyl)propanamide;hydrochloride (PubChem CID 120611896) has the molecular formula C17H29ClN2O and a molecular weight of 312.88 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-(2,2-diethylbutyl)propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-(2,2-diethylbutyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120611896 |
| Molecular Formula | C17H29ClN2O |
| Molecular Weight | 312.88 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 3-(2-aminophenyl)-N-(2,2-diethylbutyl)propanamide;hydrochloride |
| SMILES | CCC(CC)(CC)CNC(=O)CCc1ccccc1N.Cl |
| InChI | InChI=1S/C17H28N2O.ClH/c1-4-17(5-2,6-3)13-19-16(20)12-11-14-9-7-8-10-15(14)18;/h7-10H,4-6,11-13,18H2,1-3H3,(H,19,20);1H |
| InChIKey | JEEJXWXMRIXCNG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|