C18H23ClN2O3S — CID 120611481
3-(2-aminophenyl)-N-[[2-(methylsulfonylmethyl)phenyl]methyl]propanamide;hydrochloride (PubChem CID 120611481) has the molecular formula C18H23ClN2O3S and a molecular weight of 382.91 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[[2-(methylsulfonylmethyl)phenyl]methyl]propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[[2-(methylsulfonylmethyl)phenyl]methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120611481 |
| Molecular Formula | C18H23ClN2O3S |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 3-(2-aminophenyl)-N-[[2-(methylsulfonylmethyl)phenyl]methyl]propanamide;hydrochloride |
| SMILES | CS(=O)(=O)Cc1ccccc1CNC(=O)CCc1ccccc1N.Cl |
| InChI | InChI=1S/C18H22N2O3S.ClH/c1-24(22,23)13-16-8-3-2-7-15(16)12-20-18(21)11-10-14-6-4-5-9-17(14)19;/h2-9H,10-13,19H2,1H3,(H,20,21);1H |
| InChIKey | UFPMMEPQHQQVFG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|