C19H22N2OS — CID 120610683
3-(2-aminophenyl)-N-[(1-phenylsulfanylcyclopropyl)methyl]propanamide (PubChem CID 120610683) has the molecular formula C19H22N2OS and a molecular weight of 326.47 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[(1-phenylsulfanylcyclopropyl)methyl]propanamide.
| Compound Name | 3-(2-aminophenyl)-N-[(1-phenylsulfanylcyclopropyl)methyl]propanamide |
|---|---|
| PubChem CID | 120610683 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-(2-aminophenyl)-N-[(1-phenylsulfanylcyclopropyl)methyl]propanamide |
| SMILES | Nc1ccccc1CCC(=O)NCC1(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N2OS/c20-17-9-5-4-6-15(17)10-11-18(22)21-14-19(12-13-19)23-16-7-2-1-3-8-16/h1-9H,10-14,20H2,(H,21,22) |
| InChIKey | FIFGCVILGPROOC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|