C21H27FN2O2 — CID 120610892
3-(2-aminophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-N-(2-methylpropyl)propanamide (PubChem CID 120610892) has the molecular formula C21H27FN2O2 and a molecular weight of 358.46 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-N-(2-methylpropyl)propanamide.
| Compound Name | 3-(2-aminophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 120610892 |
| Molecular Formula | C21H27FN2O2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 3-(2-aminophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CN(CC(O)c1ccc(F)cc1)C(=O)CCc1ccccc1N |
| InChI | InChI=1S/C21H27FN2O2/c1-15(2)13-24(14-20(25)17-7-10-18(22)11-8-17)21(26)12-9-16-5-3-4-6-19(16)23/h3-8,10-11,15,20,25H,9,12-14,23H2,1-2H3 |
| InChIKey | PMLVEHVBUYNRIV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|