C17H25ClN2O2 — CID 120611037
3-(2-aminophenyl)-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)propanamide;hydrochloride (PubChem CID 120611037) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120611037 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3-(2-aminophenyl)-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)propanamide;hydrochloride |
| SMILES | CC1(C)C(NC(=O)CCc2ccccc2N)C2CCOC21.Cl |
| InChI | InChI=1S/C17H24N2O2.ClH/c1-17(2)15(12-9-10-21-16(12)17)19-14(20)8-7-11-5-3-4-6-13(11)18;/h3-6,12,15-16H,7-10,18H2,1-2H3,(H,19,20);1H |
| InChIKey | WVGUWYMLDGLEJD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|