C22H31Cl2N3O — CID 120612982
3-(2-aminophenyl)-N-(1-benzyl-2-methylpiperidin-4-yl)propanamide;dihydrochloride (PubChem CID 120612982) has the molecular formula C22H31Cl2N3O and a molecular weight of 424.42 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-(1-benzyl-2-methylpiperidin-4-yl)propanamide;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-(1-benzyl-2-methylpiperidin-4-yl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120612982 |
| Molecular Formula | C22H31Cl2N3O |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-(2-aminophenyl)-N-(1-benzyl-2-methylpiperidin-4-yl)propanamide;dihydrochloride |
| SMILES | CC1CC(NC(=O)CCc2ccccc2N)CCN1Cc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C22H29N3O.2ClH/c1-17-15-20(13-14-25(17)16-18-7-3-2-4-8-18)24-22(26)12-11-19-9-5-6-10-21(19)23;;/h2-10,17,20H,11-16,23H2,1H3,(H,24,26);2*1H |
| InChIKey | QPINTEJAGXHDRK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|