C18H25N3OS — CID 120613336
3-(2-aminophenyl)-N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N-methylpropanamide (PubChem CID 120613336) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N-methylpropanamide.
| Compound Name | 3-(2-aminophenyl)-N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 120613336 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 3-(2-aminophenyl)-N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N-methylpropanamide |
| SMILES | CCc1nc(C)c(C(C)N(C)C(=O)CCc2ccccc2N)s1 |
| InChI | InChI=1S/C18H25N3OS/c1-5-16-20-12(2)18(23-16)13(3)21(4)17(22)11-10-14-8-6-7-9-15(14)19/h6-9,13H,5,10-11,19H2,1-4H3 |
| InChIKey | LEDYFCSRIHVLEI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|