C17H23Cl2N3OS — CID 120613359
3-(2-aminophenyl)-N-[cyclopropyl-(4-methyl-1,3-thiazol-2-yl)methyl]propanamide;dihydrochloride (PubChem CID 120613359) has the molecular formula C17H23Cl2N3OS and a molecular weight of 388.36 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[cyclopropyl-(4-methyl-1,3-thiazol-2-yl)methyl]propanamide;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[cyclopropyl-(4-methyl-1,3-thiazol-2-yl)methyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120613359 |
| Molecular Formula | C17H23Cl2N3OS |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-(2-aminophenyl)-N-[cyclopropyl-(4-methyl-1,3-thiazol-2-yl)methyl]propanamide;dihydrochloride |
| SMILES | Cc1csc(C(NC(=O)CCc2ccccc2N)C2CC2)n1.Cl.Cl |
| InChI | InChI=1S/C17H21N3OS.2ClH/c1-11-10-22-17(19-11)16(13-6-7-13)20-15(21)9-8-12-4-2-3-5-14(12)18;;/h2-5,10,13,16H,6-9,18H2,1H3,(H,20,21);2*1H |
| InChIKey | GBHDHPYNGVHBGE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|