C21H25ClN2O3 — CID 120609675
3-(2-aminophenyl)-N-[cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]propanamide;hydrochloride (PubChem CID 120609675) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120609675 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-(2-aminophenyl)-N-[cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]propanamide;hydrochloride |
| SMILES | Cl.Nc1ccccc1CCC(=O)NC(c1ccc2c(c1)OCCO2)C1CC1 |
| InChI | InChI=1S/C21H24N2O3.ClH/c22-17-4-2-1-3-14(17)8-10-20(24)23-21(15-5-6-15)16-7-9-18-19(13-16)26-12-11-25-18;/h1-4,7,9,13,15,21H,5-6,8,10-12,22H2,(H,23,24);1H |
| InChIKey | MLEYFRVXMHYHGA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|