C26H26N2O3 — CID 60542651
1-benzhydryl-3-[cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]urea (PubChem CID 60542651) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-benzhydryl-3-[cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]urea.
| Compound Name | 1-benzhydryl-3-[cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]urea |
|---|---|
| PubChem CID | 60542651 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-benzhydryl-3-[cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methyl]urea |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)NC(c1ccc2c(c1)OCCO2)C1CC1 |
| InChI | InChI=1S/C26H26N2O3/c29-26(27-24(18-7-3-1-4-8-18)19-9-5-2-6-10-19)28-25(20-11-12-20)21-13-14-22-23(17-21)31-16-15-30-22/h1-10,13-14,17,20,24-25H,11-12,15-16H2,(H2,27,28,29) |
| InChIKey | HWKASQCJCGIFOH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |