C15H15N3O6 — CID 120613834
3-[3-[[2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]phenyl]propanoic acid (PubChem CID 120613834) has the molecular formula C15H15N3O6 and a molecular weight of 333.30 g/mol. Its IUPAC name is 3-[3-[[2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[3-[[2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 120613834 |
| Molecular Formula | C15H15N3O6 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 3-[3-[[2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]phenyl]propanoic acid |
| SMILES | CN1C(=O)C(=O)N(CC(=O)Nc2cccc(CCC(=O)O)c2)C1=O |
| InChI | InChI=1S/C15H15N3O6/c1-17-13(22)14(23)18(15(17)24)8-11(19)16-10-4-2-3-9(7-10)5-6-12(20)21/h2-4,7H,5-6,8H2,1H3,(H,16,19)(H,20,21) |
| InChIKey | IYURJXNKQFSZBI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|