C14H27NO3 — CID 120614230
(2S)-2-(3,5-dimethylhexanoylamino)hexanoic acid (PubChem CID 120614230) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethylhexanoylamino)hexanoic acid.
| Compound Name | (2S)-2-(3,5-dimethylhexanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 120614230 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | (2S)-2-(3,5-dimethylhexanoylamino)hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)CC(C)CC(C)C)C(=O)O |
| InChI | InChI=1S/C14H27NO3/c1-5-6-7-12(14(17)18)15-13(16)9-11(4)8-10(2)3/h10-12H,5-9H2,1-4H3,(H,15,16)(H,17,18)/t11?,12-/m0/s1 |
| InChIKey | RAXLAEPSUDDHOS-KIYNQFGBSA-N |
| XLogP | 2.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |