(2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid

C14H25NO3 — CID 89000831

IUPAC(2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid
SMILESC=C(C)CC(C)CC(=O)N[C@H](CCCC)C(=O)O
InChIInChI=1S/C14H25NO3/c1-5-6-7-12(14(17)18)15-13(16)9-11(4)8-10(2)3/h11-12H,2,5-9H2,1,3-4H3,(H,15,16)(H,17,18)/t11?,12-/m1/s1
InChIKeyGXQCBPZGIVCOAM-PIJUOVFKSA-N
MW255.36 g/mol
LogP2.74
Rot. Bonds9

About (2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid

(2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid (PubChem CID 89000831) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid.

Molecular Properties

Compound Name(2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid
PubChem CID89000831
Molecular FormulaC14H25NO3
Molecular Weight255.36 g/mol
Exact Mass255.18
IUPAC Name(2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid
SMILESC=C(C)CC(C)CC(=O)N[C@H](CCCC)C(=O)O
InChIInChI=1S/C14H25NO3/c1-5-6-7-12(14(17)18)15-13(16)9-11(4)8-10(2)3/h11-12H,2,5-9H2,1,3-4H3,(H,15,16)(H,17,18)/t11?,12-/m1/s1
InChIKeyGXQCBPZGIVCOAM-PIJUOVFKSA-N
XLogP2.74
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.36
LogP ≤ 52.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid?
The IUPAC name of (2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid (CID 89000831) is (2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid.
What is the SMILES notation for (2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid?
The canonical SMILES for (2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid is C=C(C)CC(C)CC(=O)N[C@H](CCCC)C(=O)O.
What is the InChIKey of (2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid?
The InChIKey is GXQCBPZGIVCOAM-PIJUOVFKSA-N. The full InChI is InChI=1S/C14H25NO3/c1-5-6-7-12(14(17)18)15-13(16)9-11(4)8-10(2)3/h11-12H,2,5-9H2,1,3-4H3,(H,15,16)(H,17,18)/t11?,12-/m1/s1.
What are the key properties of (2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid?
(2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid has a molecular weight of 255.36 g/mol, XLogP of 2.74, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,5-dimethylhex-5-enoylamino)hexanoic acid is sourced from PubChem (CID 89000831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).