C12H18ClN3OS — CID 120616267
2-(2-aminoethyl)-N,N-bis(prop-2-enyl)-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 120616267) has the molecular formula C12H18ClN3OS and a molecular weight of 287.82 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N,N-bis(prop-2-enyl)-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(2-aminoethyl)-N,N-bis(prop-2-enyl)-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120616267 |
| Molecular Formula | C12H18ClN3OS |
| Molecular Weight | 287.82 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-(2-aminoethyl)-N,N-bis(prop-2-enyl)-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | C=CCN(CC=C)C(=O)c1csc(CCN)n1.Cl |
| InChI | InChI=1S/C12H17N3OS.ClH/c1-3-7-15(8-4-2)12(16)10-9-17-11(14-10)5-6-13;/h3-4,9H,1-2,5-8,13H2;1H |
| InChIKey | QIRTYLRMLITDLH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.82 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|