C12H17FO4 — CID 12061667
methyl (Z)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoroprop-2-enoate (PubChem CID 12061667) has the molecular formula C12H17FO4 and a molecular weight of 244.26 g/mol. Its IUPAC name is methyl (Z)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoroprop-2-enoate.
| Compound Name | methyl (Z)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 12061667 |
| Molecular Formula | C12H17FO4 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | methyl (Z)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoroprop-2-enoate |
| SMILES | COC(=O)/C(F)=C/[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C12H17FO4/c1-15-11(14)10(13)7-9-8-16-12(17-9)5-3-2-4-6-12/h7,9H,2-6,8H2,1H3/b10-7-/t9-/m0/s1 |
| InChIKey | IVORUVNZQCTSNG-CBFJXKFUSA-N |
| XLogP | 2.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|