C19H24ClN3O — CID 120617047
2-(5-amino-2-pyridinyl)-N-benzyl-N-(1-cyclopropylethyl)acetamide;hydrochloride (PubChem CID 120617047) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-N-benzyl-N-(1-cyclopropylethyl)acetamide;hydrochloride.
| Compound Name | 2-(5-amino-2-pyridinyl)-N-benzyl-N-(1-cyclopropylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120617047 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-N-benzyl-N-(1-cyclopropylethyl)acetamide;hydrochloride |
| SMILES | CC(C1CC1)N(Cc1ccccc1)C(=O)Cc1ccc(N)cn1.Cl |
| InChI | InChI=1S/C19H23N3O.ClH/c1-14(16-7-8-16)22(13-15-5-3-2-4-6-15)19(23)11-18-10-9-17(20)12-21-18;/h2-6,9-10,12,14,16H,7-8,11,13,20H2,1H3;1H |
| InChIKey | QCBVKLTURPHPIW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |