C17H24N2O — CID 120619878
(2S,4S)-N-benzyl-N-cyclopropyl-2-methylpiperidine-4-carboxamide (PubChem CID 120619878) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (2S,4S)-N-benzyl-N-cyclopropyl-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-benzyl-N-cyclopropyl-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120619878 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (2S,4S)-N-benzyl-N-cyclopropyl-2-methylpiperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)N(Cc2ccccc2)C2CC2)CCN1 |
| InChI | InChI=1S/C17H24N2O/c1-13-11-15(9-10-18-13)17(20)19(16-7-8-16)12-14-5-3-2-4-6-14/h2-6,13,15-16,18H,7-12H2,1H3/t13-,15-/m0/s1 |
| InChIKey | PFUFLXQPOWMSFW-ZFWWWQNUSA-N |
| XLogP | 2.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |