C17H23N3O3 — CID 120639685
(2S,4S)-N-cyclopropyl-2-methyl-N-[(2-nitrophenyl)methyl]piperidine-4-carboxamide (PubChem CID 120639685) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2S,4S)-N-cyclopropyl-2-methyl-N-[(2-nitrophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-cyclopropyl-2-methyl-N-[(2-nitrophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120639685 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (2S,4S)-N-cyclopropyl-2-methyl-N-[(2-nitrophenyl)methyl]piperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)N(Cc2ccccc2[N+](=O)[O-])C2CC2)CCN1 |
| InChI | InChI=1S/C17H23N3O3/c1-12-10-13(8-9-18-12)17(21)19(15-6-7-15)11-14-4-2-3-5-16(14)20(22)23/h2-5,12-13,15,18H,6-11H2,1H3/t12-,13-/m0/s1 |
| InChIKey | BJRDWAVLJMDZPL-STQMWFEESA-N |
| XLogP | 2.47 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|