C16H20ClN3O2 — CID 120620251
2-(5-amino-2-pyridinyl)-N-[1-(3-methoxyphenyl)ethyl]acetamide;hydrochloride (PubChem CID 120620251) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-N-[1-(3-methoxyphenyl)ethyl]acetamide;hydrochloride.
| Compound Name | 2-(5-amino-2-pyridinyl)-N-[1-(3-methoxyphenyl)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120620251 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-N-[1-(3-methoxyphenyl)ethyl]acetamide;hydrochloride |
| SMILES | COc1cccc(C(C)NC(=O)Cc2ccc(N)cn2)c1.Cl |
| InChI | InChI=1S/C16H19N3O2.ClH/c1-11(12-4-3-5-15(8-12)21-2)19-16(20)9-14-7-6-13(17)10-18-14;/h3-8,10-11H,9,17H2,1-2H3,(H,19,20);1H |
| InChIKey | FSTSHMAEKSICCT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |