C17H26ClN3O4 — CID 120621053
N-(4-acetamido-3-methoxyphenyl)-4-(methoxymethyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 120621053) has the molecular formula C17H26ClN3O4 and a molecular weight of 371.87 g/mol. Its IUPAC name is N-(4-acetamido-3-methoxyphenyl)-4-(methoxymethyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-(4-acetamido-3-methoxyphenyl)-4-(methoxymethyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120621053 |
| Molecular Formula | C17H26ClN3O4 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-(4-acetamido-3-methoxyphenyl)-4-(methoxymethyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | COCC1(C(=O)Nc2ccc(NC(C)=O)c(OC)c2)CCNCC1.Cl |
| InChI | InChI=1S/C17H25N3O4.ClH/c1-12(21)19-14-5-4-13(10-15(14)24-3)20-16(22)17(11-23-2)6-8-18-9-7-17;/h4-5,10,18H,6-9,11H2,1-3H3,(H,19,21)(H,20,22);1H |
| InChIKey | ZWKIGXJRUVFYBX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |