C15H22FN3O4S — CID 120619844
N-[4-fluoro-3-(methanesulfonamido)phenyl]-4-(methoxymethyl)piperidine-4-carboxamide (PubChem CID 120619844) has the molecular formula C15H22FN3O4S and a molecular weight of 359.42 g/mol. Its IUPAC name is N-[4-fluoro-3-(methanesulfonamido)phenyl]-4-(methoxymethyl)piperidine-4-carboxamide.
| Compound Name | N-[4-fluoro-3-(methanesulfonamido)phenyl]-4-(methoxymethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120619844 |
| Molecular Formula | C15H22FN3O4S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[4-fluoro-3-(methanesulfonamido)phenyl]-4-(methoxymethyl)piperidine-4-carboxamide |
| SMILES | COCC1(C(=O)Nc2ccc(F)c(NS(C)(=O)=O)c2)CCNCC1 |
| InChI | InChI=1S/C15H22FN3O4S/c1-23-10-15(5-7-17-8-6-15)14(20)18-11-3-4-12(16)13(9-11)19-24(2,21)22/h3-4,9,17,19H,5-8,10H2,1-2H3,(H,18,20) |
| InChIKey | KWIJCMUQPNSIOK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |