C17H24FN3O3 — CID 120635085
N-[3-(dimethylcarbamoyl)-4-fluorophenyl]-4-(methoxymethyl)piperidine-4-carboxamide (PubChem CID 120635085) has the molecular formula C17H24FN3O3 and a molecular weight of 337.40 g/mol. Its IUPAC name is N-[3-(dimethylcarbamoyl)-4-fluorophenyl]-4-(methoxymethyl)piperidine-4-carboxamide.
| Compound Name | N-[3-(dimethylcarbamoyl)-4-fluorophenyl]-4-(methoxymethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120635085 |
| Molecular Formula | C17H24FN3O3 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[3-(dimethylcarbamoyl)-4-fluorophenyl]-4-(methoxymethyl)piperidine-4-carboxamide |
| SMILES | COCC1(C(=O)Nc2ccc(F)c(C(=O)N(C)C)c2)CCNCC1 |
| InChI | InChI=1S/C17H24FN3O3/c1-21(2)15(22)13-10-12(4-5-14(13)18)20-16(23)17(11-24-3)6-8-19-9-7-17/h4-5,10,19H,6-9,11H2,1-3H3,(H,20,23) |
| InChIKey | KMZMIVYDNGORHJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |