C17H28ClN3O — CID 120621478
2-(5-amino-2-pyridinyl)-N-(2-tert-butylcyclohexyl)acetamide;hydrochloride (PubChem CID 120621478) has the molecular formula C17H28ClN3O and a molecular weight of 325.88 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-N-(2-tert-butylcyclohexyl)acetamide;hydrochloride.
| Compound Name | 2-(5-amino-2-pyridinyl)-N-(2-tert-butylcyclohexyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120621478 |
| Molecular Formula | C17H28ClN3O |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-N-(2-tert-butylcyclohexyl)acetamide;hydrochloride |
| SMILES | CC(C)(C)C1CCCCC1NC(=O)Cc1ccc(N)cn1.Cl |
| InChI | InChI=1S/C17H27N3O.ClH/c1-17(2,3)14-6-4-5-7-15(14)20-16(21)10-13-9-8-12(18)11-19-13;/h8-9,11,14-15H,4-7,10,18H2,1-3H3,(H,20,21);1H |
| InChIKey | HFGZTCKRVBTANO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |