C14H20ClN3O — CID 120633899
2-(5-amino-2-pyridinyl)-N-(2-bicyclo[2.2.1]heptanyl)acetamide;hydrochloride (PubChem CID 120633899) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-N-(2-bicyclo[2.2.1]heptanyl)acetamide;hydrochloride.
| Compound Name | 2-(5-amino-2-pyridinyl)-N-(2-bicyclo[2.2.1]heptanyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120633899 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-N-(2-bicyclo[2.2.1]heptanyl)acetamide;hydrochloride |
| SMILES | Cl.Nc1ccc(CC(=O)NC2CC3CCC2C3)nc1 |
| InChI | InChI=1S/C14H19N3O.ClH/c15-11-3-4-12(16-8-11)7-14(18)17-13-6-9-1-2-10(13)5-9;/h3-4,8-10,13H,1-2,5-7,15H2,(H,17,18);1H |
| InChIKey | NKEVNPLIJQWXKU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |