C20H26N2O — CID 120622117
5-amino-N-[2,4-di(propan-2-yl)phenyl]-2-methylbenzamide (PubChem CID 120622117) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 5-amino-N-[2,4-di(propan-2-yl)phenyl]-2-methylbenzamide.
| Compound Name | 5-amino-N-[2,4-di(propan-2-yl)phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 120622117 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 5-amino-N-[2,4-di(propan-2-yl)phenyl]-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)Nc1ccc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C20H26N2O/c1-12(2)15-7-9-19(17(10-15)13(3)4)22-20(23)18-11-16(21)8-6-14(18)5/h6-13H,21H2,1-5H3,(H,22,23) |
| InChIKey | BHPDLXHLBUTKLX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|