C19H22ClN3O2 — CID 120622525
5-amino-2-methyl-N-[3-(2-oxopiperidin-1-yl)phenyl]benzamide;hydrochloride (PubChem CID 120622525) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[3-(2-oxopiperidin-1-yl)phenyl]benzamide;hydrochloride.
| Compound Name | 5-amino-2-methyl-N-[3-(2-oxopiperidin-1-yl)phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120622525 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5-amino-2-methyl-N-[3-(2-oxopiperidin-1-yl)phenyl]benzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)Nc1cccc(N2CCCCC2=O)c1.Cl |
| InChI | InChI=1S/C19H21N3O2.ClH/c1-13-8-9-14(20)11-17(13)19(24)21-15-5-4-6-16(12-15)22-10-3-2-7-18(22)23;/h4-6,8-9,11-12H,2-3,7,10,20H2,1H3,(H,21,24);1H |
| InChIKey | MMUVOSMGJCDZHO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|