C16H24Cl2N2O3 — CID 120623811
N-[2-(3-chlorophenoxy)ethyl]-4-(methoxymethyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 120623811) has the molecular formula C16H24Cl2N2O3 and a molecular weight of 363.29 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]-4-(methoxymethyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]-4-(methoxymethyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120623811 |
| Molecular Formula | C16H24Cl2N2O3 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]-4-(methoxymethyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | COCC1(C(=O)NCCOc2cccc(Cl)c2)CCNCC1.Cl |
| InChI | InChI=1S/C16H23ClN2O3.ClH/c1-21-12-16(5-7-18-8-6-16)15(20)19-9-10-22-14-4-2-3-13(17)11-14;/h2-4,11,18H,5-10,12H2,1H3,(H,19,20);1H |
| InChIKey | JVFQOLFJEUIKIP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|