C17H25BrN2O3 — CID 120625061
(2S,4S)-N-(2-bromo-4,5-diethoxyphenyl)-2-methylpiperidine-4-carboxamide (PubChem CID 120625061) has the molecular formula C17H25BrN2O3 and a molecular weight of 385.30 g/mol. Its IUPAC name is (2S,4S)-N-(2-bromo-4,5-diethoxyphenyl)-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-(2-bromo-4,5-diethoxyphenyl)-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120625061 |
| Molecular Formula | C17H25BrN2O3 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (2S,4S)-N-(2-bromo-4,5-diethoxyphenyl)-2-methylpiperidine-4-carboxamide |
| SMILES | CCOc1cc(Br)c(NC(=O)[C@H]2CCN[C@@H](C)C2)cc1OCC |
| InChI | InChI=1S/C17H25BrN2O3/c1-4-22-15-9-13(18)14(10-16(15)23-5-2)20-17(21)12-6-7-19-11(3)8-12/h9-12,19H,4-8H2,1-3H3,(H,20,21)/t11-,12-/m0/s1 |
| InChIKey | YNMWJKHAPCHDMP-RYUDHWBXSA-N |
| XLogP | 3.57 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |