C22H25ClN4O — CID 120626408
5-amino-2-methyl-N-[4-methyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrazol-5-yl]benzamide;hydrochloride (PubChem CID 120626408) has the molecular formula C22H25ClN4O and a molecular weight of 396.92 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[4-methyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrazol-5-yl]benzamide;hydrochloride.
| Compound Name | 5-amino-2-methyl-N-[4-methyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrazol-5-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120626408 |
| Molecular Formula | C22H25ClN4O |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 5-amino-2-methyl-N-[4-methyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrazol-5-yl]benzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)Nc1c(C)cnn1C1CCCc2ccccc21.Cl |
| InChI | InChI=1S/C22H24N4O.ClH/c1-14-10-11-17(23)12-19(14)22(27)25-21-15(2)13-24-26(21)20-9-5-7-16-6-3-4-8-18(16)20;/h3-4,6,8,10-13,20H,5,7,9,23H2,1-2H3,(H,25,27);1H |
| InChIKey | QOYFYHKOHYUJLX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|