C23H24N4O3S — CID 52507457
(2S)-N-[4-methyl-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrazol-5-yl]-2-(4-nitrophenyl)sulfanylpropanamide (PubChem CID 52507457) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is (2S)-N-[4-methyl-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrazol-5-yl]-2-(4-nitrophenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-[4-methyl-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrazol-5-yl]-2-(4-nitrophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 52507457 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (2S)-N-[4-methyl-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrazol-5-yl]-2-(4-nitrophenyl)sulfanylpropanamide |
| SMILES | Cc1cnn([C@H]2CCCc3ccccc32)c1NC(=O)[C@H](C)Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H24N4O3S/c1-15-14-24-26(21-9-5-7-17-6-3-4-8-20(17)21)22(15)25-23(28)16(2)31-19-12-10-18(11-13-19)27(29)30/h3-4,6,8,10-14,16,21H,5,7,9H2,1-2H3,(H,25,28)/t16-,21-/m0/s1 |
| InChIKey | HDZLDGZGKNWCRF-KKSFZXQISA-N |
| XLogP | 5.14 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|