C15H20N2O5S — CID 120627451
(3aS,7aS)-2-[2-(methoxymethyl)-4-methyl-1,3-thiazole-5-carbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120627451) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is (3aS,7aS)-2-[2-(methoxymethyl)-4-methyl-1,3-thiazole-5-carbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[2-(methoxymethyl)-4-methyl-1,3-thiazole-5-carbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120627451 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (3aS,7aS)-2-[2-(methoxymethyl)-4-methyl-1,3-thiazole-5-carbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | COCc1nc(C)c(C(=O)N2C[C@H]3COCC[C@@]3(C(=O)O)C2)s1 |
| InChI | InChI=1S/C15H20N2O5S/c1-9-12(23-11(16-9)7-21-2)13(18)17-5-10-6-22-4-3-15(10,8-17)14(19)20/h10H,3-8H2,1-2H3,(H,19,20)/t10-,15+/m0/s1 |
| InChIKey | XKDNMLNZTOQINZ-ZUZCIYMTSA-N |
| XLogP | 1.16 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |