C20H21NO5 — CID 120627566
(3aS,7aS)-2-(2-naphthalen-2-yloxyacetyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120627566) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is (3aS,7aS)-2-(2-naphthalen-2-yloxyacetyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-(2-naphthalen-2-yloxyacetyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120627566 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (3aS,7aS)-2-(2-naphthalen-2-yloxyacetyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | O=C(COc1ccc2ccccc2c1)N1C[C@H]2COCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C20H21NO5/c22-18(12-26-17-6-5-14-3-1-2-4-15(14)9-17)21-10-16-11-25-8-7-20(16,13-21)19(23)24/h1-6,9,16H,7-8,10-13H2,(H,23,24)/t16-,20+/m0/s1 |
| InChIKey | JRZRUJMUGQYNPE-OXJNMPFZSA-N |
| XLogP | 2.17 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |