C16H22ClN3O2 — CID 120628552
4-(5-amino-2-methylbenzoyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one;hydrochloride (PubChem CID 120628552) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 4-(5-amino-2-methylbenzoyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one;hydrochloride.
| Compound Name | 4-(5-amino-2-methylbenzoyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one;hydrochloride |
|---|---|
| PubChem CID | 120628552 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 4-(5-amino-2-methylbenzoyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)N1CC(=O)NC2CCCCC21.Cl |
| InChI | InChI=1S/C16H21N3O2.ClH/c1-10-6-7-11(17)8-12(10)16(21)19-9-15(20)18-13-4-2-3-5-14(13)19;/h6-8,13-14H,2-5,9,17H2,1H3,(H,18,20);1H |
| InChIKey | ZIGLKBLITJVVFQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|