About 3,5-dibromobenzoic acid
3,5-dibromobenzoic acid (PubChem CID 12063) has the molecular formula C7H4Br2O2
and a molecular weight of 279.92 g/mol. Its IUPAC name is 3,5-dibromobenzoic acid.
Molecular Properties
| Compound Name | 3,5-dibromobenzoic acid |
| PubChem CID | 12063 |
| Molecular Formula | C7H4Br2O2 |
| Molecular Weight | 279.92 g/mol |
| Exact Mass | 277.86 |
| IUPAC Name | 3,5-dibromobenzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C7H4Br2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11) |
| InChIKey | SFTFNJZWZHASAQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.92 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dibromobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromobenzoic acid?
The IUPAC name of 3,5-dibromobenzoic acid (CID 12063) is 3,5-dibromobenzoic acid.
What is the SMILES notation for 3,5-dibromobenzoic acid?
The canonical SMILES for 3,5-dibromobenzoic acid is O=C(O)c1cc(Br)cc(Br)c1.
What is the InChIKey of 3,5-dibromobenzoic acid?
The InChIKey is SFTFNJZWZHASAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Br2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11).
What are the key properties of 3,5-dibromobenzoic acid?
3,5-dibromobenzoic acid has a molecular weight of 279.92 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromobenzoic acid is sourced from PubChem (CID 12063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).