About 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide
2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide (PubChem CID 120630032) has the molecular formula C15H17N3O2S
and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 120630032 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide |
| SMILES | NCCc1nc(C(=O)Nc2ccc3c(c2)CCCO3)cs1 |
| InChI | InChI=1S/C15H17N3O2S/c16-6-5-14-18-12(9-21-14)15(19)17-11-3-4-13-10(8-11)2-1-7-20-13/h3-4,8-9H,1-2,5-7,16H2,(H,17,19) |
| InChIKey | UBUAVBPOTNNWRQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide (CID 120630032) is 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide is NCCc1nc(C(=O)Nc2ccc3c(c2)CCCO3)cs1.
What is the InChIKey of 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide?
The InChIKey is UBUAVBPOTNNWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2S/c16-6-5-14-18-12(9-21-14)15(19)17-11-3-4-13-10(8-11)2-1-7-20-13/h3-4,8-9H,1-2,5-7,16H2,(H,17,19).
What are the key properties of 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide?
2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide has a molecular weight of 303.39 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)-N-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 120630032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).