C19H21FN2O — CID 120634471
5-amino-N-(5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2-methylbenzamide (PubChem CID 120634471) has the molecular formula C19H21FN2O and a molecular weight of 312.39 g/mol. Its IUPAC name is 5-amino-N-(5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2-methylbenzamide.
| Compound Name | 5-amino-N-(5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 120634471 |
| Molecular Formula | C19H21FN2O |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5-amino-N-(5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)NC1c2cccc(F)c2CCC1C |
| InChI | InChI=1S/C19H21FN2O/c1-11-6-8-13(21)10-16(11)19(23)22-18-12(2)7-9-14-15(18)4-3-5-17(14)20/h3-6,8,10,12,18H,7,9,21H2,1-2H3,(H,22,23) |
| InChIKey | VLDKMNNWYUZOGL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|