C19H25ClN2OS — CID 120635670
5-amino-2-methyl-N-[2-methyl-3-(propan-2-ylsulfanylmethyl)phenyl]benzamide;hydrochloride (PubChem CID 120635670) has the molecular formula C19H25ClN2OS and a molecular weight of 364.94 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[2-methyl-3-(propan-2-ylsulfanylmethyl)phenyl]benzamide;hydrochloride.
| Compound Name | 5-amino-2-methyl-N-[2-methyl-3-(propan-2-ylsulfanylmethyl)phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120635670 |
| Molecular Formula | C19H25ClN2OS |
| Molecular Weight | 364.94 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 5-amino-2-methyl-N-[2-methyl-3-(propan-2-ylsulfanylmethyl)phenyl]benzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)Nc1cccc(CSC(C)C)c1C.Cl |
| InChI | InChI=1S/C19H24N2OS.ClH/c1-12(2)23-11-15-6-5-7-18(14(15)4)21-19(22)17-10-16(20)9-8-13(17)3;/h5-10,12H,11,20H2,1-4H3,(H,21,22);1H |
| InChIKey | RMTNMKDJDLONCH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|