C16H19N3OS — CID 71999234
N-[2-methyl-3-(propan-2-ylsulfanylmethyl)phenyl]pyrazine-2-carboxamide (PubChem CID 71999234) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is N-[2-methyl-3-(propan-2-ylsulfanylmethyl)phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-methyl-3-(propan-2-ylsulfanylmethyl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 71999234 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-[2-methyl-3-(propan-2-ylsulfanylmethyl)phenyl]pyrazine-2-carboxamide |
| SMILES | Cc1c(CSC(C)C)cccc1NC(=O)c1cnccn1 |
| InChI | InChI=1S/C16H19N3OS/c1-11(2)21-10-13-5-4-6-14(12(13)3)19-16(20)15-9-17-7-8-18-15/h4-9,11H,10H2,1-3H3,(H,19,20) |
| InChIKey | KZHTXHPLUZFLLE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |