C16H24N2O3S — CID 120635998
5-amino-N,2-dimethyl-N-(2-methylsulfonylcyclohexyl)benzamide (PubChem CID 120635998) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 5-amino-N,2-dimethyl-N-(2-methylsulfonylcyclohexyl)benzamide.
| Compound Name | 5-amino-N,2-dimethyl-N-(2-methylsulfonylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 120635998 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 5-amino-N,2-dimethyl-N-(2-methylsulfonylcyclohexyl)benzamide |
| SMILES | Cc1ccc(N)cc1C(=O)N(C)C1CCCCC1S(C)(=O)=O |
| InChI | InChI=1S/C16H24N2O3S/c1-11-8-9-12(17)10-13(11)16(19)18(2)14-6-4-5-7-15(14)22(3,20)21/h8-10,14-15H,4-7,17H2,1-3H3 |
| InChIKey | VQVCMJJHUFHICL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|