C16H21NO5S — CID 125132908
4-[methyl-[(1S,2S)-2-methylsulfonylcyclohexyl]carbamoyl]benzoic acid (PubChem CID 125132908) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is 4-[methyl-[(1S,2S)-2-methylsulfonylcyclohexyl]carbamoyl]benzoic acid.
| Compound Name | 4-[methyl-[(1S,2S)-2-methylsulfonylcyclohexyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 125132908 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 4-[methyl-[(1S,2S)-2-methylsulfonylcyclohexyl]carbamoyl]benzoic acid |
| SMILES | CN(C(=O)c1ccc(C(=O)O)cc1)[C@H]1CCCC[C@@H]1S(C)(=O)=O |
| InChI | InChI=1S/C16H21NO5S/c1-17(13-5-3-4-6-14(13)23(2,21)22)15(18)11-7-9-12(10-8-11)16(19)20/h7-10,13-14H,3-6H2,1-2H3,(H,19,20)/t13-,14-/m0/s1 |
| InChIKey | UAVUYGVYKKGLCX-KBPBESRZSA-N |
| XLogP | 1.81 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |