C15H23ClN4O2 — CID 120638870
3-[(5-amino-2-methylbenzoyl)amino]-N-ethylpyrrolidine-1-carboxamide;hydrochloride (PubChem CID 120638870) has the molecular formula C15H23ClN4O2 and a molecular weight of 326.83 g/mol. Its IUPAC name is 3-[(5-amino-2-methylbenzoyl)amino]-N-ethylpyrrolidine-1-carboxamide;hydrochloride.
| Compound Name | 3-[(5-amino-2-methylbenzoyl)amino]-N-ethylpyrrolidine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120638870 |
| Molecular Formula | C15H23ClN4O2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-[(5-amino-2-methylbenzoyl)amino]-N-ethylpyrrolidine-1-carboxamide;hydrochloride |
| SMILES | CCNC(=O)N1CCC(NC(=O)c2cc(N)ccc2C)C1.Cl |
| InChI | InChI=1S/C15H22N4O2.ClH/c1-3-17-15(21)19-7-6-12(9-19)18-14(20)13-8-11(16)5-4-10(13)2;/h4-5,8,12H,3,6-7,9,16H2,1-2H3,(H,17,21)(H,18,20);1H |
| InChIKey | ZGPSKCZFSWPJHQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|