C20H30FN3O2 — CID 120641513
N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-(methoxymethyl)piperidine-4-carboxamide (PubChem CID 120641513) has the molecular formula C20H30FN3O2 and a molecular weight of 363.48 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-(methoxymethyl)piperidine-4-carboxamide.
| Compound Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-(methoxymethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120641513 |
| Molecular Formula | C20H30FN3O2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-(methoxymethyl)piperidine-4-carboxamide |
| SMILES | COCC1(C(=O)NC2CCN(Cc3ccc(F)cc3)CC2)CCNCC1 |
| InChI | InChI=1S/C20H30FN3O2/c1-26-15-20(8-10-22-11-9-20)19(25)23-18-6-12-24(13-7-18)14-16-2-4-17(21)5-3-16/h2-5,18,22H,6-15H2,1H3,(H,23,25) |
| InChIKey | VAUHGAKBKRFZFU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |