C22H29N3O2 — CID 120641589
5-amino-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-2-methylbenzamide (PubChem CID 120641589) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 5-amino-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-2-methylbenzamide.
| Compound Name | 5-amino-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 120641589 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 5-amino-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)NCc1ccc(CN2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-15-4-9-20(23)10-21(15)22(26)24-11-18-5-7-19(8-6-18)14-25-12-16(2)27-17(3)13-25/h4-10,16-17H,11-14,23H2,1-3H3,(H,24,26) |
| InChIKey | PFQIFEKDENPLSF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|