C22H27N3O3 — CID 120626034
5-amino-N-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-2-methylbenzamide (PubChem CID 120626034) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 5-amino-N-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-2-methylbenzamide.
| Compound Name | 5-amino-N-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 120626034 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 5-amino-N-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)NCc1ccc(C(=O)N2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-14-4-9-19(23)10-20(14)21(26)24-11-17-5-7-18(8-6-17)22(27)25-12-15(2)28-16(3)13-25/h4-10,15-16H,11-13,23H2,1-3H3,(H,24,26) |
| InChIKey | AWLVBFSDMORGJH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|